EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O3 |
| Net Charge | 0 |
| Average Mass | 186.251 |
| Monoisotopic Mass | 186.12559 |
| SMILES | CCCCCCCCC(=O)C(=O)O |
| InChI | InChI=1S/C10H18O3/c1-2-3-4-5-6-7-8-9(11)10(12)13/h2-8H2,1H3,(H,12,13) |
| InChIKey | JBFDBSZCFDASAE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alexandrium tamarense (ncbitaxon:2926) | - | PubMed (24172212) | |
| Vitis vinifera (ncbitaxon:29760) | - | PubMed (29938203) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxodecanoic acid (CHEBI:34301) has functional parent decanoic acid (CHEBI:30813) |
| 2-oxodecanoic acid (CHEBI:34301) has role algal metabolite (CHEBI:84735) |
| 2-oxodecanoic acid (CHEBI:34301) has role plant metabolite (CHEBI:76924) |
| 2-oxodecanoic acid (CHEBI:34301) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 2-oxodecanoic acid (CHEBI:34301) is conjugate acid of 2-oxodecanotate (CHEBI:176592) |
| Incoming Relation(s) |
| 2-oxodecanotate (CHEBI:176592) is conjugate base of 2-oxodecanoic acid (CHEBI:34301) |
| IUPAC Name |
|---|
| 2-oxodecanoic acid |
| Synonyms | Source |
|---|---|
| 2-oxo capric acid | LIPID MAPS |
| 2-ketocapric acid | ChEBI |
| 2-oxocapric acid | ChEBI |
| α-ketocapric acid | ChEBI |
| 2-oxo-decanoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C13945 | KEGG COMPOUND |
| LMFA01060001 | LIPID MAPS |
| 228032 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:333-60-8 | ChEBI |
| Citations |
|---|