EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H34O3 |
| Net Charge | 0 |
| Average Mass | 286.456 |
| Monoisotopic Mass | 286.25079 |
| SMILES | CCCCCCCCCCCCCCC(OC)C(=O)O |
| InChI | InChI=1S/C17H34O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(20-2)17(18)19/h16H,3-15H2,1-2H3,(H,18,19) |
| InChIKey | YNBIUHDYZWCBSF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methoxyhexadecanoic acid (CHEBI:34295) has functional parent hexadecanoic acid (CHEBI:15756) |
| 2-methoxyhexadecanoic acid (CHEBI:34295) is a long-chain fatty acid (CHEBI:15904) |
| Incoming Relation(s) |
| (R)-2-methoxyhexadecanoic acid (CHEBI:38244) is a 2-methoxyhexadecanoic acid (CHEBI:34295) |
| IUPAC Name |
|---|
| 2-methoxyhexadecanoic acid |
| Synonyms | Source |
|---|---|
| 2-Methoxyhexadecanoate | KEGG COMPOUND |
| 2-methoxy-hexadecanoic acid | LIPID MAPS |
| 2-Methoxyhexadecanoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C13947 | KEGG COMPOUND |
| LMFA01080009 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1786815 | Beilstein |
| Citations |
|---|