EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5NS2 |
| Net Charge | 0 |
| Average Mass | 167.258 |
| Monoisotopic Mass | 166.98634 |
| SMILES | Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C7H5NS2/c9-7-8-5-3-1-2-4-6(5)10-7/h1-4H,(H,8,9) |
| InChIKey | YXIWHUQXZSMYRE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3-benzothiazole-2-thiol (CHEBI:34292) has role carcinogenic agent (CHEBI:50903) |
| 1,3-benzothiazole-2-thiol (CHEBI:34292) has role metabolite (CHEBI:25212) |
| 1,3-benzothiazole-2-thiol (CHEBI:34292) is a aryl thiol (CHEBI:82711) |
| 1,3-benzothiazole-2-thiol (CHEBI:34292) is a benzothiazoles (CHEBI:37947) |
| Incoming Relation(s) |
| dibenzothiazol-2-yl disulfide (CHEBI:53239) has functional parent 1,3-benzothiazole-2-thiol (CHEBI:34292) |
| tyrphostin AG 825 (CHEBI:75405) has functional parent 1,3-benzothiazole-2-thiol (CHEBI:34292) |
| IUPAC Name |
|---|
| 1,3-benzothiazole-2-thiol |
| Synonyms | Source |
|---|---|
| 1,3-Benzothiazol-2-yl hydrosulfide | NIST Chemistry WebBook |
| 2-Benzothiazolethiol | ChemIDplus |
| 2-MBT | ChemIDplus |
| 2-Mercaptobenzothiazole | KEGG COMPOUND |
| 2-sulfanyl-1,3-benzothiazole | ChEBI |
| Benzothiazole-2-thiol | ChEMBL |
| Citations |
|---|