EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5NS2 |
| Net Charge | 0 |
| Average Mass | 167.258 |
| Monoisotopic Mass | 166.98634 |
| SMILES | Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C7H5NS2/c9-7-8-5-3-1-2-4-6(5)10-7/h1-4H,(H,8,9) |
| InChIKey | YXIWHUQXZSMYRE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3-benzothiazole-2-thiol (CHEBI:34292) has role carcinogenic agent (CHEBI:50903) |
| 1,3-benzothiazole-2-thiol (CHEBI:34292) has role metabolite (CHEBI:25212) |
| 1,3-benzothiazole-2-thiol (CHEBI:34292) is a aryl thiol (CHEBI:82711) |
| 1,3-benzothiazole-2-thiol (CHEBI:34292) is a benzothiazoles (CHEBI:37947) |
| Incoming Relation(s) |
| dibenzothiazol-2-yl disulfide (CHEBI:53239) has functional parent 1,3-benzothiazole-2-thiol (CHEBI:34292) |
| tyrphostin AG 825 (CHEBI:75405) has functional parent 1,3-benzothiazole-2-thiol (CHEBI:34292) |
| IUPAC Name |
|---|
| 1,3-benzothiazole-2-thiol |
| Synonyms | Source |
|---|---|
| 1,3-Benzothiazol-2-yl hydrosulfide | NIST Chemistry WebBook |
| 2-Benzothiazolethiol | ChemIDplus |
| 2-MBT | ChemIDplus |
| 2-Mercaptobenzothiazole | KEGG COMPOUND |
| 2-sulfanyl-1,3-benzothiazole | ChEBI |
| Benzothiazole-2-thiol | ChEMBL |
| Citations |
|---|