EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10O |
| Net Charge | 0 |
| Average Mass | 182.222 |
| Monoisotopic Mass | 182.07316 |
| SMILES | Oc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10O/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8,14H,7H2 |
| InChIKey | ZDOIAPGLORMKTR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (22815468) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Hydroxyfluorene (CHEBI:34289) is a fluorenes (CHEBI:24059) |
| Synonyms | Source |
|---|---|
| 2-Hydroxyfluorene | KEGG COMPOUND |
| Fluoren-2-ol | KEGG COMPOUND |
| 2-Hydroxy fluorene | HMDB |
| 9H-Fluoren-2-ol | HMDB |
| 9H-fluoren-2-ol | HMDB |
| 2-Fluorenol | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C14460 | KEGG COMPOUND |
| HMDB0013163 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:2443-58-5 | KEGG COMPOUND |
| Citations |
|---|