EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:34283 - oxybenzone
| Formula | C14H12O3 |
| Net Charge | 0 |
| Average Mass | 228.247 |
| Monoisotopic Mass | 228.07864 |
| SMILES | COc1ccc(C(=O)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C14H12O3/c1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10/h2-9,15H,1H3 |
| InChIKey | DXGLGDHPHMLXJC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | ultraviolet filter A photochemical role realized in the absorption of ultraviolet light, for example to protect skin cells from damage. environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. protective agent Synthetic or natural substance which is given to prevent a disease or disorder or are used in the process of treating a disease or injury due to a poisonous agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxybenzone (CHEBI:34283) has role dermatologic drug (CHEBI:50177) |
| oxybenzone (CHEBI:34283) has role environmental contaminant (CHEBI:78298) |
| oxybenzone (CHEBI:34283) has role protective agent (CHEBI:50267) |
| oxybenzone (CHEBI:34283) has role ultraviolet filter (CHEBI:73335) |
| oxybenzone (CHEBI:34283) has role xenobiotic (CHEBI:35703) |
| oxybenzone (CHEBI:34283) is a hydroxybenzophenone (CHEBI:24677) |
| oxybenzone (CHEBI:34283) is a monomethoxybenzene (CHEBI:25235) |
| IUPAC Name |
|---|
| (2-hydroxy-4-methoxyphenyl)(phenyl)methanone |
| INNs | Source |
|---|---|
| oxibenzona | ChemIDplus |
| oxybenzone | ChemIDplus |
| oxybenzonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-Benzoyl-5-methoxyphenol | DrugBank |
| 2-Hydroxy-4-methoxybenzophenone | KEGG COMPOUND |
| 4-Methoxy-2-hydroxybenzophenone | DrugBank |
| Benzophenone-3 | ChemIDplus |
| Citations |
|---|