EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:34283 - oxybenzone
| Formula | C14H12O3 |
| Net Charge | 0 |
| Average Mass | 228.247 |
| Monoisotopic Mass | 228.07864 |
| SMILES | COc1ccc(C(=O)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C14H12O3/c1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10/h2-9,15H,1H3 |
| InChIKey | DXGLGDHPHMLXJC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. ultraviolet filter A photochemical role realized in the absorption of ultraviolet light, for example to protect skin cells from damage. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. protective agent Synthetic or natural substance which is given to prevent a disease or disorder or are used in the process of treating a disease or injury due to a poisonous agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxybenzone (CHEBI:34283) has role dermatologic drug (CHEBI:50177) |
| oxybenzone (CHEBI:34283) has role environmental contaminant (CHEBI:78298) |
| oxybenzone (CHEBI:34283) has role protective agent (CHEBI:50267) |
| oxybenzone (CHEBI:34283) has role ultraviolet filter (CHEBI:73335) |
| oxybenzone (CHEBI:34283) has role xenobiotic (CHEBI:35703) |
| oxybenzone (CHEBI:34283) is a hydroxybenzophenone (CHEBI:24677) |
| oxybenzone (CHEBI:34283) is a monomethoxybenzene (CHEBI:25235) |
| IUPAC Name |
|---|
| (2-hydroxy-4-methoxyphenyl)(phenyl)methanone |
| INNs | Source |
|---|---|
| oxibenzona | ChemIDplus |
| oxybenzonum | ChemIDplus |
| oxybenzone | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-Hydroxy-4-methoxybenzophenone | KEGG COMPOUND |
| Benzophenone-3 | ChemIDplus |
| 2-Benzoyl-5-methoxyphenol | DrugBank |
| 4-Methoxy-2-hydroxybenzophenone | DrugBank |
| Citations |
|---|