EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12 |
| Net Charge | 0 |
| Average Mass | 156.228 |
| Monoisotopic Mass | 156.09390 |
| SMILES | Cc1ccc2cc(C)ccc2c1 |
| InChI | InChI=1S/C12H12/c1-9-3-5-12-8-10(2)4-6-11(12)7-9/h3-8H,1-2H3 |
| InChIKey | YGYNBBAUIYTWBF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dimethylnaphthalene (CHEBI:34251) has role environmental contaminant (CHEBI:78298) |
| 2,6-dimethylnaphthalene (CHEBI:34251) is a dimethylnaphthalene (CHEBI:48853) |
| IUPAC Name |
|---|
| 2,6-dimethylnaphthalene |
| Synonyms | Source |
|---|---|
| 2,6-Dimethylnaphthalene | KEGG COMPOUND |
| 2,6-DMN | Patent |
| Manual Xrefs | Databases |
|---|---|
| 2,6-Dimethylnaphthalene | Wikipedia |
| C14330 | KEGG COMPOUND |
| EP1852409 | Patent |
| HMDB0059764 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1903544 | Reaxys |
| CAS:581-42-0 | NIST Chemistry WebBook |
| CAS:581-42-0 | KEGG COMPOUND |
| Citations |
|---|