EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8Cl2O |
| Net Charge | 0 |
| Average Mass | 239.101 |
| Monoisotopic Mass | 237.99522 |
| SMILES | Oc1ccc(-c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C12H8Cl2O/c13-10-2-1-3-11(14)12(10)8-4-6-9(15)7-5-8/h1-7,15H |
| InChIKey | WJZSSXLAIVPJLA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dichloro-4'-biphenylol (CHEBI:34248) has functional parent biphenyl-4-ol (CHEBI:34422) |
| 2,6-dichloro-4'-biphenylol (CHEBI:34248) has role metabolite (CHEBI:25212) |
| 2,6-dichloro-4'-biphenylol (CHEBI:34248) is a dichlorobenzene (CHEBI:23697) |
| 2,6-dichloro-4'-biphenylol (CHEBI:34248) is a hydroxybiphenyls (CHEBI:24681) |
| IUPAC Name |
|---|
| 2',6'-dichlorobiphenyl-4-ol |
| Synonyms | Source |
|---|---|
| 2',6'-Dichloro-(1,1'-biphenyl)-4-ol | KEGG COMPOUND |
| 2,6-Dichloro-4'-biphenylol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C14192 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8685526 | Reaxys |
| CAS:79881-33-7 | ChemIDplus |