EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:34238 - 2,4-dibromophenol
| Formula | C6H4Br2O |
| Net Charge | 0 |
| Average Mass | 251.905 |
| Monoisotopic Mass | 249.86289 |
| SMILES | Oc1ccc(Br)cc1Br |
| InChI | InChI=1S/C6H4Br2O/c7-4-1-2-6(9)5(8)3-4/h1-3,9H |
| InChIKey | FAXWFCTVSHEODL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Grateloupia elliptica (ncbitaxon:118371) | - | PubMed (18951591) | |
| Neosiphonia sphaerocarpa (WORMS:146348) | - | PubMed (10656411) |
| Roles Classification |
|---|
| Chemical Role: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. |
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Application: | flame retardant Any compound that is added to manufactured materials to inhibit, suppress, or delay the production of flames and so prevent the spread of fire. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dibromophenol (CHEBI:34238) has role marine metabolite (CHEBI:76507) |
| 2,4-dibromophenol (CHEBI:34238) is a brominated flame retardant (CHEBI:172368) |
| 2,4-dibromophenol (CHEBI:34238) is a bromophenol (CHEBI:33624) |
| 2,4-dibromophenol (CHEBI:34238) is a dibromobenzene (CHEBI:37147) |
| Synonym | Source |
|---|---|
| 2,4-DBP | ChEBI |
| UniProt Name | Source |
|---|---|
| 2,4-dibromophenol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2,4-Dibromophenol | Wikipedia |
| C00033541 | KNApSAcK |
| C14521 | KEGG COMPOUND |
| FDB008794 | FooDB |
| HMDB0032079 | HMDB |
| Citations |
|---|