EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10N2 |
| Net Charge | 0 |
| Average Mass | 122.171 |
| Monoisotopic Mass | 122.08440 |
| SMILES | Cc1ccc(N)cc1N |
| InChI | InChI=1S/C7H10N2/c1-5-2-3-6(8)4-7(5)9/h2-4H,8-9H2,1H3 |
| InChIKey | VOZKAJLKRJDJLL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-diaminotoluene (CHEBI:34237) has functional parent p-toluidine (CHEBI:37825) |
| 2,4-diaminotoluene (CHEBI:34237) has role metabolite (CHEBI:25212) |
| 2,4-diaminotoluene (CHEBI:34237) is a aminotoluene (CHEBI:22531) |
| IUPAC Name |
|---|
| 4-methylbenzene-1,3-diamine |