EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2O3 |
| Net Charge | 0 |
| Average Mass | 326.396 |
| Monoisotopic Mass | 326.16304 |
| SMILES | [H][C@]12NCCC[C@@]1([H])C=C1C(O)CN3Cc4cc5c(cc4[C@@]2([H])[C@@]13[H])OCO5 |
| InChI | InChI=1S/C19H22N2O3/c22-14-8-21-7-11-5-15-16(24-9-23-15)6-12(11)17-18-10(2-1-3-20-18)4-13(14)19(17)21/h4-6,10,14,17-20,22H,1-3,7-9H2/t10-,14?,17+,18-,19+/m0/s1 |
| InChIKey | YZJARFWVCIXVDT-DVORTUFPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Caribine (CHEBI:3417) is a alkaloid (CHEBI:22315) |
| Synonym | Source |
|---|---|
| Caribine | KEGG COMPOUND |