EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H31FO2 |
| Net Charge | 0 |
| Average Mass | 274.420 |
| Monoisotopic Mass | 274.23081 |
| SMILES | O=C(O)CCCCCCCCCCCCCCCF |
| InChI | InChI=1S/C16H31FO2/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h1-15H2,(H,18,19) |
| InChIKey | PNNLLDRVJFDXNL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-Fluorohexadecanoic acid (CHEBI:34164) is a fluoro fatty acid (CHEBI:60693) |
| 16-Fluorohexadecanoic acid (CHEBI:34164) is a long-chain fatty acid (CHEBI:15904) |
| Synonyms | Source |
|---|---|
| 16-Fluorohexadecanoic acid | KEGG COMPOUND |
| 16-Fluoropalmitic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C13948 | KEGG COMPOUND |