EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O3 |
| Net Charge | 0 |
| Average Mass | 320.473 |
| Monoisotopic Mass | 320.23514 |
| SMILES | CCCCC/C=C\C[C@H](O)/C=C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O3/c1-2-3-4-5-10-13-16-19(21)17-14-11-8-6-7-9-12-15-18-20(22)23/h7-11,13-14,17,19,21H,2-6,12,15-16,18H2,1H3,(H,22,23)/b9-7-,11-8-,13-10-,17-14+/t19-/m0/s1 |
| InChIKey | ZNHVWPKMFKADKW-LQWMCKPYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | pro-angiogenic agent Any compound that promotes the growth of new blood vessels from pre-existing vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12(S)-HETE (CHEBI:34146) has role human metabolite (CHEBI:77746) |
| 12(S)-HETE (CHEBI:34146) has role pro-angiogenic agent (CHEBI:72571) |
| 12(S)-HETE (CHEBI:34146) is a (5Z,8Z,10E,14Z)-12-hydroxyicosatetraenoic acid (CHEBI:84447) |
| 12(S)-HETE (CHEBI:34146) is a HETE (CHEBI:36275) |
| 12(S)-HETE (CHEBI:34146) is conjugate acid of 12(S)-HETE(1−) (CHEBI:90680) |
| 12(S)-HETE (CHEBI:34146) is enantiomer of 12(R)-HETE (CHEBI:34144) |
| Incoming Relation(s) |
| 12(S)-HETE(1−) (CHEBI:90680) is conjugate base of 12(S)-HETE (CHEBI:34146) |
| 12(R)-HETE (CHEBI:34144) is enantiomer of 12(S)-HETE (CHEBI:34146) |
| IUPAC Name |
|---|
| (5Z,8Z,10E,12S,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 12(S)-HETE | KEGG COMPOUND |
| (5Z,8Z,10E,14Z)-(12S)-12-Hydroxyeicosa-5,8,10,14-tetraenoic acid | KEGG COMPOUND |
| (5Z,8Z,10E,14Z)-(12S)-12-Hydroxyicosa-5,8,10,14-tetraenoic acid | KEGG COMPOUND |
| 12S-HETE | LIPID MAPS |
| (5Z,8Z,10E,12S,14Z)-12-hydroxyeicosa-5,8,10,14-tetraenoic acid | ChEBI |
| 12(S)-hydroxy-5(Z),8(Z),10(E),14(Z)-eicosatetraenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C14777 | KEGG COMPOUND |
| LMFA03060007 | LIPID MAPS |
| C00000424 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2656104 | Reaxys |
| CAS:54397-83-0 | KEGG COMPOUND |
| Citations |
|---|