EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | [H][C@@]12CC[C@](C)(O)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C20H30O3/c1-18-8-6-13(21)10-12(18)4-5-14-15-7-9-20(3,23)19(15,2)11-16(22)17(14)18/h10,14-17,22-23H,4-9,11H2,1-3H3/t14-,15-,16-,17+,18-,19-,20-/m0/s1 |
| InChIKey | UBIBSXMTVJAYTQ-OWLVHUDESA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11beta,17beta-Dihydroxy-17-methylandrost-4-en-3-one (CHEBI:34140) has role androgen (CHEBI:50113) |
| 11beta,17beta-Dihydroxy-17-methylandrost-4-en-3-one (CHEBI:34140) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| 11beta,17beta-Dihydroxy-17-methylandrost-4-en-3-one | KEGG COMPOUND |
| 11beta-Hydroxy-17alpha-methyltestosterone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C14683 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:1043-10-3 | KEGG COMPOUND |