EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O3 |
| Net Charge | 0 |
| Average Mass | 304.430 |
| Monoisotopic Mass | 304.20384 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@]4([H])CCC(=O)[C@@]4(C)CC(=O)[C@]3([H])[C@@]1(C)CC[C@@H](O)C2 |
| InChI | InChI=1S/C19H28O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h11-14,17,20H,3-10H2,1-2H3/t11-,12-,13+,14+,17-,18+,19+/m1/s1 |
| InChIKey | IUNYGQONJQTULL-UKZLPJRTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (12707870) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-Ketoetiocholanolone (CHEBI:34135) has role androgen (CHEBI:50113) |
| 11-Ketoetiocholanolone (CHEBI:34135) is a 3-hydroxy steroid (CHEBI:36834) |
| Incoming Relation(s) |
| 11-ketoetiocholanolone 3-O-(beta-D-glucuronide) (CHEBI:746874) has functional parent 11-Ketoetiocholanolone (CHEBI:34135) |
| Synonyms | Source |
|---|---|
| 11-Ketoetiocholanolone | KEGG COMPOUND |
| 11-Oxoaetiocholanolone | HMDB |
| 11-Oxoetiocholanolone | HMDB |
| (1S,2S,5R,7R,10S,11S,15S)-5-hydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecane-14,17-dione | HMDB |
| (3alpha,5beta)-3-hydroxy-Androstane-11,17-dione | HMDB |
| 3alpha-Hydroxy-11,17-dioxo-5beta-androstane | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C14552 | KEGG COMPOUND |
| HMDB0006031 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:739-27-5 | KEGG COMPOUND |
| Citations |
|---|