EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H9NO2 |
| Net Charge | 0 |
| Average Mass | 247.253 |
| Monoisotopic Mass | 247.06333 |
| SMILES | O=[N+]([O-])c1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C16H9NO2/c18-17(19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H |
| InChIKey | ALRLPDGCPYIVHP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-nitropyrene (CHEBI:34107) has parent hydride pyrene (CHEBI:39106) |
| 1-nitropyrene (CHEBI:34107) has role carcinogenic agent (CHEBI:50903) |
| 1-nitropyrene (CHEBI:34107) is a nitroarene (CHEBI:51132) |
| IUPAC Name |
|---|
| 1-nitropyrene |
| Synonyms | Source |
|---|---|
| 1-Nitropyrene | KEGG COMPOUND |
| 3-Nitropyrene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C14421 | KEGG COMPOUND |
| 1-Nitropyrene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1882811 | Reaxys |
| CAS:5522-43-0 | KEGG COMPOUND |
| CAS:5522-43-0 | ChemIDplus |
| Citations |
|---|