EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13NO2 |
| Net Charge | 0 |
| Average Mass | 239.274 |
| Monoisotopic Mass | 239.09463 |
| SMILES | CC(=O)Nc1ccc2c(c1O)Cc1ccccc1-2 |
| InChI | InChI=1S/C15H13NO2/c1-9(17)16-14-7-6-12-11-5-3-2-4-10(11)8-13(12)15(14)18/h2-7,18H,8H2,1H3,(H,16,17) |
| InChIKey | IQPIBKBOFOVHBP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-Hydroxy-2-acetamidofluorene (CHEBI:34090) is a fluorenes (CHEBI:24059) |
| Synonyms | Source |
|---|---|
| 1-Hydroxy-2-acetamidofluorene | KEGG COMPOUND |
| 1-Hydroxy-N-2-fluorenylacetamide | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C14481 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:2784-86-3 | KEGG COMPOUND |