EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H38O4 |
| Net Charge | 0 |
| Average Mass | 378.553 |
| Monoisotopic Mass | 378.27701 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC[C@@H](O)CO |
| InChI | InChI=1S/C23H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(26)27-21-22(25)20-24/h6-7,9-10,12-13,15-16,22,24-25H,2-5,8,11,14,17-21H2,1H3/b7-6-,10-9-,13-12-,16-15-/t22-/m0/s1 |
| InChIKey | DCPCOKIYJYGMDN-HUDVFFLJSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-arachidonoyl-sn-glycerol (CHEBI:34071) is a 1-acyl-sn-glycerol (CHEBI:64683) |
| 1-arachidonoyl-sn-glycerol (CHEBI:34071) is a 1-arachidonoylglycerol (CHEBI:75612) |
| 1-arachidonoyl-sn-glycerol (CHEBI:34071) is enantiomer of 3-arachidonoyl-sn-glycerol (CHEBI:75571) |
| Incoming Relation(s) |
| rac-1-arachidonoylglycerol (CHEBI:75572) has part 1-arachidonoyl-sn-glycerol (CHEBI:34071) |
| 3-arachidonoyl-sn-glycerol (CHEBI:75571) is enantiomer of 1-arachidonoyl-sn-glycerol (CHEBI:34071) |
| IUPAC Name |
|---|
| (2S)-2,3-dihydroxypropyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| Synonyms | Source |
|---|---|
| 1-Arachidonoylglycerol | KEGG COMPOUND |
| 1-Arachidonoyl-sn-glycerol | KEGG COMPOUND |
| (S)-glyceryl 1-arachidonate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 1-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-sn-glycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C13857 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9229411 | Reaxys |
| Beilstein:9806383 | Beilstein |
| CAS:124511-15-5 | ChemIDplus |