EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12 |
| Net Charge | 0 |
| Average Mass | 120.195 |
| Monoisotopic Mass | 120.09390 |
| SMILES | Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C9H12/c1-7-4-5-8(2)9(3)6-7/h4-6H,1-3H3 |
| InChIKey | GWHJZXXIDMPWGX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | neurotoxin A poison that interferes with the functions of the nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2,4-trimethylbenzene (CHEBI:34039) has role neurotoxin (CHEBI:50910) |
| 1,2,4-trimethylbenzene (CHEBI:34039) is a trimethylbenzene (CHEBI:38641) |
| Incoming Relation(s) |
| 2,3,5-trimethylphenol (CHEBI:38570) has parent hydride 1,2,4-trimethylbenzene (CHEBI:34039) |
| IUPAC Name |
|---|
| 1,2,4-trimethylbenzene |
| Synonyms | Source |
|---|---|
| 1,2,4-Trimethylbenzene | KEGG COMPOUND |
| Pseudocumene | KEGG COMPOUND |
| 1,3,4-Trimethylbenzene | ChemIDplus |
| Pseudocumol | ChemIDplus |
| Psi-cumene | ChemIDplus |
| Uns-trimethylbenzene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C14533 | KEGG COMPOUND |
| PSEUDOCUMENE | MetaCyc |
| 1,2,4-Trimethylbenzene | Wikipedia |
| HMDB0013733 | HMDB |
| Citations |
|---|