EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12 |
| Net Charge | 0 |
| Average Mass | 120.195 |
| Monoisotopic Mass | 120.09390 |
| SMILES | Cc1cccc(C)c1C |
| InChI | InChI=1S/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3 |
| InChIKey | FYGHSUNMUKGBRK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. neurotoxin A poison that interferes with the functions of the nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2,3-trimethylbenzene (CHEBI:34037) has role neurotoxin (CHEBI:50910) |
| 1,2,3-trimethylbenzene (CHEBI:34037) has role plant metabolite (CHEBI:76924) |
| 1,2,3-trimethylbenzene (CHEBI:34037) is a trimethylbenzene (CHEBI:38641) |
| Incoming Relation(s) |
| 3,4,5-trimethylphenol (CHEBI:38896) has parent hydride 1,2,3-trimethylbenzene (CHEBI:34037) |
| IUPAC Name |
|---|
| 1,2,3-trimethylbenzene |
| Synonyms | Source |
|---|---|
| 1,2,3-Trimethylbenzene | KEGG COMPOUND |
| hemellitol | ChemIDplus |
| Hemimellitene | KEGG COMPOUND |
| hemimellitol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1,2,3-Trimethylbenzene | Wikipedia |
| C14518 | KEGG COMPOUND |
| HMDB0059901 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1903410 | Reaxys |
| Gmelin:326517 | Gmelin |
| CAS:526-73-8 | NIST Chemistry WebBook |
| CAS:526-73-8 | KEGG COMPOUND |
| Citations |
|---|