EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:34031 - 1,1-dichloroethene
| Formula | C2H2Cl2 |
| Net Charge | 0 |
| Average Mass | 96.944 |
| Monoisotopic Mass | 95.95336 |
| SMILES | C=C(Cl)Cl |
| InChI | InChI=1S/C2H2Cl2/c1-2(3)4/h1H2 |
| InChIKey | LGXVIGDEPROXKC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,1-dichloroethene (CHEBI:34031) has role carcinogenic agent (CHEBI:50903) |
| 1,1-dichloroethene (CHEBI:34031) has role mouse metabolite (CHEBI:75771) |
| 1,1-dichloroethene (CHEBI:34031) has role mutagen (CHEBI:25435) |
| 1,1-dichloroethene (CHEBI:34031) is a chloroethenes (CHEBI:23142) |
| IUPAC Name |
|---|
| 1,1-dichloroethene |
| Synonyms | Source |
|---|---|
| 1,1-Dichloroethylene | KEGG COMPOUND |
| Vinylidene chloride | KEGG COMPOUND |
| vinylidene dichloride | ChemIDplus |
| 1,1-DCE | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 1,1-dichloroethene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C14039 | KEGG COMPOUND |
| 1,1-Dichloroethene | Wikipedia |
| Citations |
|---|