EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H2Cl2 |
| Net Charge | 0 |
| Average Mass | 96.944 |
| Monoisotopic Mass | 95.95336 |
| SMILES | C=C(Cl)Cl |
| InChI | InChI=1S/C2H2Cl2/c1-2(3)4/h1H2 |
| InChIKey | LGXVIGDEPROXKC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,1-dichloroethene (CHEBI:34031) has role carcinogenic agent (CHEBI:50903) |
| 1,1-dichloroethene (CHEBI:34031) has role mouse metabolite (CHEBI:75771) |
| 1,1-dichloroethene (CHEBI:34031) has role mutagen (CHEBI:25435) |
| 1,1-dichloroethene (CHEBI:34031) is a chloroethenes (CHEBI:23142) |
| IUPAC Name |
|---|
| 1,1-dichloroethene |
| Synonyms | Source |
|---|---|
| 1,1-DCE | KEGG COMPOUND |
| 1,1-Dichloroethylene | KEGG COMPOUND |
| Vinylidene chloride | KEGG COMPOUND |
| vinylidene dichloride | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 1,1-dichloroethene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1,1-Dichloroethene | Wikipedia |
| C14039 | KEGG COMPOUND |
| Citations |
|---|