EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10FN3O4 |
| Net Charge | 0 |
| Average Mass | 219.172 |
| Monoisotopic Mass | 219.06553 |
| SMILES | N[C@@H](CN1C=C(F)C(=O)NC1O)C(=O)O |
| InChI | InChI=1S/C7H10FN3O4/c8-3-1-11(2-4(9)6(13)14)7(15)10-5(3)12/h1,4,7,15H,2,9H2,(H,10,12)(H,13,14)/t4-,7?/m0/s1 |
| InChIKey | YIBVSVWKLVBIKS-LRYVRFSDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-F-Willardiine (CHEBI:34020) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonym | Source |
|---|---|
| (S)-F-Willardiine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C13671 | KEGG COMPOUND |