EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2O4 |
| Net Charge | 0 |
| Average Mass | 228.248 |
| Monoisotopic Mass | 228.11101 |
| SMILES | CC(C)(C)c1onc(O)c1C[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H16N2O4/c1-10(2,3)7-5(8(13)12-16-7)4-6(11)9(14)15/h6H,4,11H2,1-3H3,(H,12,13)(H,14,15)/t6-/m0/s1 |
| InChIKey | PIXJURSCCVBKRF-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-ATPA (CHEBI:34019) has role metabolite (CHEBI:25212) |
| (S)-ATPA (CHEBI:34019) is a isoxazoles (CHEBI:55373) |
| (S)-ATPA (CHEBI:34019) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| 3-(5-tert-butyl-3-hydroxy-1,2-oxazol-4-yl)-L-alanine |
| Manual Xrefs | Databases |
|---|---|
| CE2 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7253029 | Reaxys |