EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10N2O4 |
| Net Charge | 0 |
| Average Mass | 186.167 |
| Monoisotopic Mass | 186.06406 |
| SMILES | Cc1onc(O)c1CC(N)C(=O)O |
| InChI | InChI=1S/C7H10N2O4/c1-3-4(6(10)9-13-3)2-5(8)7(11)12/h5H,2,8H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | UUDAMDVQRQNNHZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-AMPA (CHEBI:34018) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonyms | Source |
|---|---|
| (S)-AMPA | KEGG COMPOUND |
| (S)-2-Amino-3-(3-hydroxy-5-methyl-4-isoxazolyl)propionic acid | KEGG COMPOUND |
| alpha-Amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C13672 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:77521-29-0 | KEGG COMPOUND |