EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8N2O4 |
| Net Charge | 0 |
| Average Mass | 172.140 |
| Monoisotopic Mass | 172.04841 |
| SMILES | Cc1onc(O)c1[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H8N2O4/c1-2-3(4(7)6(10)11)5(9)8-12-2/h4H,7H2,1H3,(H,8,9)(H,10,11)/t4-/m1/s1 |
| InChIKey | XIHYCWZNHQMZSX-SCSAIBSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-AMAA (CHEBI:34011) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonyms | Source |
|---|---|
| (R)-AMAA | KEGG COMPOUND |
| (R)-2-Amino-2-(3-hydroxy-5-methyl-4-isoxazolyl)acetic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C13739 | KEGG COMPOUND |