EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O6 |
| Net Charge | 0 |
| Average Mass | 290.271 |
| Monoisotopic Mass | 290.07904 |
| SMILES | Oc1cc(O)c2c(c1)O[C@@H](c1ccc(O)c(O)c1)[C@H](O)C2 |
| InChI | InChI=1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15+/m1/s1 |
| InChIKey | PFTAWBLQPZVEMU-HIFRSBDPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-catechin (CHEBI:33992) has role metabolite (CHEBI:25212) |
| (−)-catechin (CHEBI:33992) is a catechin (CHEBI:23053) |
| (−)-catechin (CHEBI:33992) is enantiomer of (+)-catechin (CHEBI:15600) |
| Incoming Relation(s) |
| (−)-catechin-3-O-gallate (CHEBI:76131) has functional parent (−)-catechin (CHEBI:33992) |
| catechin 5-glucuronide (CHEBI:149588) has functional parent (−)-catechin (CHEBI:33992) |
| rac-catechin (CHEBI:132833) has part (−)-catechin (CHEBI:33992) |
| (+)-catechin (CHEBI:15600) is enantiomer of (−)-catechin (CHEBI:33992) |
| IUPAC Name |
|---|
| (2S,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| Synonyms | Source |
|---|---|
| (2S,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-1H-benzopyran-3,5,7-triol | ChemIDplus |
| (-)-Catechin | KEGG COMPOUND |
| catechin L-form | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:18829-70-4 | KEGG COMPOUND |
| CAS:18829-70-4 | ChemIDplus |