EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9N3O2 |
| Net Charge | 0 |
| Average Mass | 191.190 |
| Monoisotopic Mass | 191.06948 |
| SMILES | COC(=O)Nc1nc2ccccc2n1 |
| InChI | InChI=1S/C9H9N3O2/c1-14-9(13)12-8-10-6-4-2-3-5-7(6)11-8/h2-5H,1H3,(H2,10,11,12,13) |
| InChIKey | TWFZGCMQGLPBSX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antinematodal drug A substance used in the treatment or control of nematode infestations. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbendazim (CHEBI:3392) has functional parent 2-aminobenzimidazole (CHEBI:27822) |
| carbendazim (CHEBI:3392) has role antifungal agrochemical (CHEBI:86328) |
| carbendazim (CHEBI:3392) has role antinematodal drug (CHEBI:35444) |
| carbendazim (CHEBI:3392) has role antineoplastic agent (CHEBI:35610) |
| carbendazim (CHEBI:3392) has role metabolite (CHEBI:25212) |
| carbendazim (CHEBI:3392) has role microtubule-destabilising agent (CHEBI:61951) |
| carbendazim (CHEBI:3392) is a benzimidazole fungicide (CHEBI:87036) |
| carbendazim (CHEBI:3392) is a benzimidazoles (CHEBI:22715) |
| carbendazim (CHEBI:3392) is a benzimidazolylcarbamate fungicide (CHEBI:87064) |
| carbendazim (CHEBI:3392) is a carbamate ester (CHEBI:23003) |
| IUPAC Name |
|---|
| methyl 1H-benzimidazol-2-ylcarbamate |
| Synonyms | Source |
|---|---|
| 1H-benzimidazol-2-ylcarbamic acid methyl ester | ChEBI |
| 2-benzimidazolecarbamic acid methyl ester | ChEBI |
| 2-(Methoxy-carbonylamino)-benzimidazol | ChemIDplus |
| 2-(methoxycarbonylamino)-benzimidazole | ChemIDplus |
| 2-(methoxycarbonylamino)benzimidazole | ChEBI |
| A 118 | ChEMBL |
| UniProt Name | Source |
|---|---|
| carbendazim | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 116 | PPDB |
| C10897 | KEGG COMPOUND |
| carbendazim | Alan Wood's Pesticides |
| Carbendazim | Wikipedia |
| HMDB0031769 | HMDB |
| US3010968 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:649044 | Reaxys |
| CAS:10605-21-7 | ChemIDplus |
| CAS:10605-21-7 | KEGG COMPOUND |
| Citations |
|---|