EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15N2O2.Cl |
| Net Charge | 0 |
| Average Mass | 182.651 |
| Monoisotopic Mass | 182.08221 |
| SMILES | C[N+](C)(C)CCOC(N)=O.[Cl-] |
| InChI | InChI=1S/C6H14N2O2.ClH/c1-8(2,3)4-5-10-6(7)9;/h4-5H2,1-3H3,(H-,7,9);1H |
| InChIKey | AIXAANGOTKPUOY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | miotic An agent causing contraction of the pupil of the eye. Because the size of the pupil is under the antagonistic control of the sympathetic and parasympathetic systems, drugs affecting either system can cause miosis. Drugs that mimic or potentiate the parasympathetic input to the circular constrictor muscle and drugs that inhibit sympathetic input to the radial dilator muscle tend to contract the pupils. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. muscarinic agonist Any drug that binds to and activates a muscarinic cholinergic receptor. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. miotic An agent causing contraction of the pupil of the eye. Because the size of the pupil is under the antagonistic control of the sympathetic and parasympathetic systems, drugs affecting either system can cause miosis. Drugs that mimic or potentiate the parasympathetic input to the circular constrictor muscle and drugs that inhibit sympathetic input to the radial dilator muscle tend to contract the pupils. antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. muscarinic agonist Any drug that binds to and activates a muscarinic cholinergic receptor. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbachol (CHEBI:3385) has role antiglaucoma drug (CHEBI:39456) |
| carbachol (CHEBI:3385) has role cardiotonic drug (CHEBI:38147) |
| carbachol (CHEBI:3385) has role miotic (CHEBI:51068) |
| carbachol (CHEBI:3385) has role muscarinic agonist (CHEBI:38325) |
| carbachol (CHEBI:3385) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| carbachol (CHEBI:3385) has role non-narcotic analgesic (CHEBI:35481) |
| carbachol (CHEBI:3385) has role ophthalmology drug (CHEBI:66981) |
| carbachol (CHEBI:3385) is a ammonium salt (CHEBI:47704) |
| carbachol (CHEBI:3385) is a carbamate ester (CHEBI:23003) |
| IUPAC Name |
|---|
| 2-(carbamoyloxy)-N,N,N-trimethylethanaminium chloride |
| INNs | Source |
|---|---|
| carbachol | WHO MedNet |
| carbacholum | WHO MedNet |
| carbacol | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-((Aminocarbonyl)oxy)-N,N,N-trimethylethanaminium chloride | ChemIDplus |
| 2-((Aminocarbonyl)oxy)-N,N,N-trimethylethanaminum chloride | ChemIDplus |
| (2-Carbamoyloxyethyl)trimethylammonium chloride | ChemIDplus |
| (2-Hydroxyethyl)trimethyl ammonium chloride carbamate | ChemIDplus |
| (2-Hydroxyethyl)trimethylammonium chloride carbamate | ChemIDplus |
| carbachol | ChemIDplus |
| Brand Name | Source |
|---|---|
| Doryl | ChEMBL |
| Citations |
|---|