EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19NO4 |
| Net Charge | 0 |
| Average Mass | 265.309 |
| Monoisotopic Mass | 265.13141 |
| SMILES | [H][C@]1(Cc2ccc(OC)cc2)NC[C@H](O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H19NO4/c1-9(16)19-14-12(15-8-13(14)17)7-10-3-5-11(18-2)6-4-10/h3-6,12-15,17H,7-8H2,1-2H3/t12-,13+,14+/m1/s1 |
| InChIKey | YKJYKKNCCRKFSL-RDBSUJKOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiparasitic agent A substance used to treat or prevent parasitic infections. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-anisomycin (CHEBI:338412) has role anticoronaviral agent (CHEBI:149553) |
| (−)-anisomycin (CHEBI:338412) has role antimicrobial agent (CHEBI:33281) |
| (−)-anisomycin (CHEBI:338412) has role antineoplastic agent (CHEBI:35610) |
| (−)-anisomycin (CHEBI:338412) has role antiparasitic agent (CHEBI:35442) |
| (−)-anisomycin (CHEBI:338412) has role bacterial metabolite (CHEBI:76969) |
| (−)-anisomycin (CHEBI:338412) has role DNA synthesis inhibitor (CHEBI:59517) |
| (−)-anisomycin (CHEBI:338412) has role protein synthesis inhibitor (CHEBI:48001) |
| (−)-anisomycin (CHEBI:338412) is a monohydroxypyrrolidine (CHEBI:46777) |
| (−)-anisomycin (CHEBI:338412) is a organonitrogen heterocyclic antibiotic (CHEBI:25558) |
| IUPAC Name |
|---|
| (2R,3S,4S)-4-hydroxy-2-(4-methoxybenzyl)pyrrolidin-3-yl acetate |
| Synonyms | Source |
|---|---|
| 1,4,5-Trideoxy-1,4-imino-5-(p-methoxyphenyl)-D-xylo-pentitol 3-acetate | ChemIDplus |
| 2-(p-Methoxybenzyl)-3,4-pyrrolidinediol 3-acetate | ChemIDplus |
| 2-p-Methoxyphenylmethyl-3-acetoxy-4-hydroxypyrrolidine | ChemIDplus |
| Anisomycin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| Anisomycin | Wikipedia |
| ANM | PDBeChem |
| C11281 | KEGG COMPOUND |
| DB07374 | DrugBank |
| LSM-4047 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20705 | Reaxys |
| CAS:22862-76-6 | ChemIDplus |
| CAS:22862-76-6 | KEGG COMPOUND |
| Citations |
|---|