EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19NO4 |
| Net Charge | 0 |
| Average Mass | 265.309 |
| Monoisotopic Mass | 265.13141 |
| SMILES | [H][C@]1(Cc2ccc(OC)cc2)NC[C@H](O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H19NO4/c1-9(16)19-14-12(15-8-13(14)17)7-10-3-5-11(18-2)6-4-10/h3-6,12-15,17H,7-8H2,1-2H3/t12-,13+,14+/m1/s1 |
| InChIKey | YKJYKKNCCRKFSL-RDBSUJKOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiparasitic agent A substance used to treat or prevent parasitic infections. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-anisomycin (CHEBI:338412) has role anticoronaviral agent (CHEBI:149553) |
| (−)-anisomycin (CHEBI:338412) has role antimicrobial agent (CHEBI:33281) |
| (−)-anisomycin (CHEBI:338412) has role antineoplastic agent (CHEBI:35610) |
| (−)-anisomycin (CHEBI:338412) has role antiparasitic agent (CHEBI:35442) |
| (−)-anisomycin (CHEBI:338412) has role bacterial metabolite (CHEBI:76969) |
| (−)-anisomycin (CHEBI:338412) has role DNA synthesis inhibitor (CHEBI:59517) |
| (−)-anisomycin (CHEBI:338412) has role protein synthesis inhibitor (CHEBI:48001) |
| (−)-anisomycin (CHEBI:338412) is a monohydroxypyrrolidine (CHEBI:46777) |
| (−)-anisomycin (CHEBI:338412) is a organonitrogen heterocyclic antibiotic (CHEBI:25558) |
| IUPAC Name |
|---|
| (2R,3S,4S)-4-hydroxy-2-(4-methoxybenzyl)pyrrolidin-3-yl acetate |
| Synonyms | Source |
|---|---|
| 1,4,5-Trideoxy-1,4-imino-5-(p-methoxyphenyl)-D-xylo-pentitol 3-acetate | ChemIDplus |
| 2-(p-Methoxybenzyl)-3,4-pyrrolidinediol 3-acetate | ChemIDplus |
| 2-p-Methoxyphenylmethyl-3-acetoxy-4-hydroxypyrrolidine | ChemIDplus |
| Anisomycin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| Anisomycin | Wikipedia |
| ANM | PDBeChem |
| C11281 | KEGG COMPOUND |
| DB07374 | DrugBank |
| LSM-4047 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20705 | Reaxys |
| CAS:22862-76-6 | ChemIDplus |
| CAS:22862-76-6 | KEGG COMPOUND |
| Citations |
|---|