EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15NO3S |
| Net Charge | 0 |
| Average Mass | 217.290 |
| Monoisotopic Mass | 217.07726 |
| SMILES | C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C9H15NO3S/c1-6(5-14)8(11)10-4-2-3-7(10)9(12)13/h6-7,14H,2-5H2,1H3,(H,12,13)/t6-,7+/m1/s1 |
| InChIKey | FAKRSMQSSFJEIM-RQJHMYQMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| captopril (CHEBI:3380) has role antihypertensive agent (CHEBI:35674) |
| captopril (CHEBI:3380) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| captopril (CHEBI:3380) is a N-acylpyrrolidine (CHEBI:46766) |
| captopril (CHEBI:3380) is a L-proline derivative (CHEBI:84186) |
| captopril (CHEBI:3380) is a alkanethiol (CHEBI:47908) |
| captopril (CHEBI:3380) is a pyrrolidinemonocarboxylic acid (CHEBI:46701) |
| Incoming Relation(s) |
| captopril disulfide (CHEBI:53236) has functional parent captopril (CHEBI:3380) |
| IUPAC Name |
|---|
| 1-[(2S)-2-methyl-3-sulfanylpropanoyl]-L-proline |
| INNs | Source |
|---|---|
| captopril | ChemIDplus |
| captoprilum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid | ChEBI |
| Captopryl | DrugBank |
| CP | ChEBI |
| L-Captopril | DrugBank |
| D-2-methyl-3-mercaptopropanoyl-L-proline | ChemIDplus |
| D-3-mercapto-2-methylpropanoyl-L-proline | ChemIDplus |
| Brand Names | Source |
|---|---|
| Acepress | DrugBank |
| Apopril | DrugBank |
| Capoten | DrugBank |
| Captolane | DrugBank |
| Captoril | DrugBank |
| Cesplon | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:477887 | Beilstein |
| CAS:62571-86-2 | ChemIDplus |
| CAS:62571-86-2 | KEGG DRUG |
| CAS:62571-86-2 | NIST Chemistry WebBook |
| Citations |
|---|