EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H27NO3 |
| Net Charge | 0 |
| Average Mass | 305.418 |
| Monoisotopic Mass | 305.19909 |
| SMILES | COc1cc(CNC(=O)CCCC/C=C/C(C)C)ccc1O |
| InChI | InChI=1S/C18H27NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h6,8,10-12,14,20H,4-5,7,9,13H2,1-3H3,(H,19,21)/b8-6+ |
| InChIKey | YKPUWZUDDOIDPM-SOFGYWHQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | TRPV1 agonist An agonist at the transient receptor potential vanilloid 1 (TRPV1). non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. voltage-gated sodium channel blocker Any sodium channel blocker that interferes with the activity of voltage-gated sodium channels. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| capsaicin (CHEBI:3374) has role non-narcotic analgesic (CHEBI:35481) |
| capsaicin (CHEBI:3374) has role TRPV1 agonist (CHEBI:140535) |
| capsaicin (CHEBI:3374) has role voltage-gated sodium channel blocker (CHEBI:38634) |
| capsaicin (CHEBI:3374) is a capsaicinoid (CHEBI:46931) |
| IUPAC Name |
|---|
| (6E)-N-(4-hydroxy-3-methoxybenzyl)-8-methylnon-6-enamide |
| Synonyms | Source |
|---|---|
| Capsaicin | KEGG COMPOUND |
| (E)-8-Methyl-N-vanillyl-6-nonenamide | ChemIDplus |
| Isodecenoic acid vanillylamide | ChemIDplus |
| trans-8-Methyl-N-vanillyl-6-nonenamide | ChemIDplus |
| Zostrix | KEGG DRUG |
| UniProt Name | Source |
|---|---|
| capsaicin | UniProt |