EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17O7 |
| Net Charge | +1 |
| Average Mass | 345.327 |
| Monoisotopic Mass | 345.09688 |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(OC)c3cc2O)cc(OC)c1O |
| InChI | InChI=1S/C18H16O7/c1-22-13-6-10(19)7-14-11(13)8-12(20)18(25-14)9-4-15(23-2)17(21)16(5-9)24-3/h4-8H,1-3H3,(H2-,19,20,21)/p+1 |
| InChIKey | GYLVPQXQQPMCKK-UHFFFAOYSA-O |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plumbago auriculata (ncbitaxon:45172) | flower (BTO:0000469) | PubMed (22260638) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| capensinidin (CHEBI:3367) has role plant metabolite (CHEBI:76924) |
| capensinidin (CHEBI:3367) is a anthocyanidin cation (CHEBI:16366) |
| IUPAC Name |
|---|
| 3,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxy-1-benzopyran-1-ium |
| Manual Xrefs | Databases |
|---|---|
| C08595 | KEGG COMPOUND |
| Capensinidin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3915526 | Reaxys |
| CAS:19077-85-1 | KEGG COMPOUND |
| Citations |
|---|