EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25NO5 |
| Net Charge | 0 |
| Average Mass | 371.433 |
| Monoisotopic Mass | 371.17327 |
| SMILES | [H][C@@]12Cc3ccc(OC)c(OC)c3CN1CCc1cc(OC)c(OC)c(O)c12 |
| InChI | InChI=1S/C21H25NO5/c1-24-16-6-5-12-9-15-18-13(10-17(25-2)21(27-4)19(18)23)7-8-22(15)11-14(12)20(16)26-3/h5-6,10,15,23H,7-9,11H2,1-4H3/t15-/m0/s1 |
| InChIKey | GSPIMPLJQOCBFY-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Capaurine (CHEBI:3366) is a alkaloid (CHEBI:22315) |
| Synonym | Source |
|---|---|
| Capaurine | KEGG COMPOUND |