EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H52O2 |
| Net Charge | 0 |
| Average Mass | 564.854 |
| Monoisotopic Mass | 564.39673 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)C(=O)CCC2(C)C)C(C)(C)CCC1=O |
| InChI | InChI=1S/C40H52O2/c1-29(17-13-19-31(3)21-23-35-33(5)37(41)25-27-39(35,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-36-34(6)38(42)26-28-40(36,9)10/h11-24H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+ |
| InChIKey | FDSDTBUPSURDBL-DKLMTRRASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| Application: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| canthaxanthin (CHEBI:3362) has parent hydride β-carotene (CHEBI:17579) |
| canthaxanthin (CHEBI:3362) has role Escherichia coli metabolite (CHEBI:76971) |
| canthaxanthin (CHEBI:3362) has role biological pigment (CHEBI:26130) |
| canthaxanthin (CHEBI:3362) has role food colouring (CHEBI:77182) |
| canthaxanthin (CHEBI:3362) has role fungal metabolite (CHEBI:76946) |
| canthaxanthin (CHEBI:3362) is a carotenone (CHEBI:35310) |
| IUPAC Name |
|---|
| β,β-carotene-4,4'-dione |
| Synonyms | Source |
|---|---|
| Canthaxanthin | KEGG COMPOUND |
| 4,4'-dioxo-β-carotene | ChemIDplus |
| all-trans-β-carotene-4,4'-dione | ChemIDplus |
| Food Orange 8 | ChemIDplus |
| Carophyll Red | ChemIDplus |
| Orobronze | ChemIDplus |
| UniProt Name | Source |
|---|---|
| canthaxanthin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C08583 | KEGG COMPOUND |
| LMPR01070264 | LIPID MAPS |
| HMDB0003154 | HMDB |
| Canthaxanthin | Wikipedia |
| C00000922 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1898520 | Reaxys |
| CAS:514-78-3 | KEGG COMPOUND |
| CAS:514-78-3 | ChemIDplus |
| Citations |
|---|