EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33NO7 |
| Net Charge | 0 |
| Average Mass | 399.484 |
| Monoisotopic Mass | 399.22570 |
| SMILES | COCCOC[C@H](CC1(C(=O)N[C@H]2CC[C@@H](C(=O)O)CC2)CCCC1)C(=O)O |
| InChI | InChI=1S/C20H33NO7/c1-27-10-11-28-13-15(18(24)25)12-20(8-2-3-9-20)19(26)21-16-6-4-14(5-7-16)17(22)23/h14-16H,2-13H2,1H3,(H,21,26)(H,22,23)(H,24,25)/t14-,15-,16+/m0/s1 |
| InChIKey | ACZWIDANLCXHBM-HRCADAONSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.4.24.* (metalloendopeptidase) inhibitor Any EC 3.4.* (hydrolases acting on peptide bond) inhibitor that interferes with the activity of a metalloendopeptidase (EC 3.4.24.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| candoxatrilat (CHEBI:3354) has role EC 3.4.24.* (metalloendopeptidase) inhibitor (CHEBI:59107) |
| candoxatrilat (CHEBI:3354) is a dicarboxylic acid (CHEBI:35692) |
| candoxatrilat (CHEBI:3354) is a dicarboxylic acid monoamide (CHEBI:35735) |
| Incoming Relation(s) |
| candoxatril (CHEBI:3353) has functional parent candoxatrilat (CHEBI:3354) |
| IUPAC Name |
|---|
| cis-4-[({1-[(2S)-2-carboxy-3-(2-methoxyethoxy)propyl]cyclopentyl}carbonyl)amino]cyclohexanecarboxylic acid |
| INN | Source |
|---|---|
| candoxatrilat | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 4-({1-[(S)-2-Carboxy-3-(2-methoxy-ethoxy)-propyl]-cyclopentanecarbonyl}-amino)-cyclohexanecarboxylic acid | ChEMBL |
| Candoxatrilat | KEGG COMPOUND |
| candoxatrilate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8365079 | Beilstein |
| CAS:123122-54-3 | ChemIDplus |
| CAS:123898-42-0 | KEGG COMPOUND |