EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C59H84N2O18 |
| Net Charge | 0 |
| Average Mass | 1109.317 |
| Monoisotopic Mass | 1108.57191 |
| SMILES | CC1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/C(OC2O[C@H](C)[C@@H](O)[C@H](N)[C@@H]2O)CC(O)C(C(=O)O)C(O)CC(=O)CC(O)CC(O)CC(O)CC(=O)CCCC(=O)CC(=O)OC1C(C)CC(C)C(O)CC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C59H84N2O18/c1-35-18-15-13-11-9-7-5-6-8-10-12-14-16-21-47(78-59-56(74)54(61)55(73)38(4)77-59)33-51(71)53(58(75)76)50(70)31-46(67)30-45(66)29-44(65)28-43(64)27-41(62)19-17-20-42(63)32-52(72)79-57(35)37(3)26-36(2)48(68)34-49(69)39-22-24-40(60)25-23-39/h5-16,18,21-25,35-38,43-45,47-48,50-51,53-57,59,64-66,68,70-71,73-74H,17,19-20,26-34,60-61H2,1-4H3,(H,75,76)/b6-5+,9-7+,10-8+,13-11+,14-12+,18-15+,21-16+/t35?,36?,37?,38-,43?,44?,45?,47?,48?,50?,51?,53?,54+,55-,56+,57?,59?/m1/s1 |
| InChIKey | OPGSFDUODIJJGF-JBUZINEHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| candicidin D (CHEBI:3349) has role antifungal drug (CHEBI:86327) |
| candicidin D (CHEBI:3349) has role bacterial metabolite (CHEBI:76969) |
| candicidin D (CHEBI:3349) is a macrolide antibiotic (CHEBI:25105) |
| candicidin D (CHEBI:3349) is a polyene antibiotic (CHEBI:26177) |
| Incoming Relation(s) |
| candicidin (CHEBI:354984) has part candicidin D (CHEBI:3349) |
| IUPAC Name |
|---|
| (23E,25E,27E,29E,31E,33E,35E)-22-[(3-amino-3,6-dideoxy-D-mannopyranosyl)oxy]-38-[7-(4-aminophenyl)-5-hydroxy-4-methyl-7-oxoheptan-2-yl]-10,12,14,18,20-pentahydroxy-37-methyl-2,4,8,16-tetraoxooxacyclooctatriaconta-23,25,27,29,31,33,35-heptaene-19-carboxylic acid |
| Synonyms | Source |
|---|---|
| Candicidin D | KEGG COMPOUND |
| levorin A2 | ChEBI |
| candicidin D1 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C06690 | KEGG COMPOUND |
| DB01152 | DrugBank |
| Candicidin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9183661 | Beilstein |
| CAS:39372-30-0 | KEGG COMPOUND |
| CAS:39372-30-0 | ChemIDplus |
| Citations |
|---|