EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3347 - candesartan
| Formula | C24H20N6O3 |
| Net Charge | 0 |
| Average Mass | 440.463 |
| Monoisotopic Mass | 440.15969 |
| SMILES | CCOc1nc2cccc(C(=O)O)c2n1Cc1ccc(-c2ccccc2-c2nnnn2)cc1 |
| InChI | InChI=1S/C24H20N6O3/c1-2-33-24-25-20-9-5-8-19(23(31)32)21(20)30(24)14-15-10-12-16(13-11-15)17-6-3-4-7-18(17)22-26-28-29-27-22/h3-13H,2,14H2,1H3,(H,31,32)(H,26,27,28,29) |
| InChIKey | HTQMVQVXFRQIKW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| candesartan (CHEBI:3347) has role angiotensin receptor antagonist (CHEBI:61016) |
| candesartan (CHEBI:3347) has role anti-arrhythmia drug (CHEBI:38070) |
| candesartan (CHEBI:3347) has role antihypertensive agent (CHEBI:35674) |
| candesartan (CHEBI:3347) has role antipsychotic agent (CHEBI:35476) |
| candesartan (CHEBI:3347) has role antiviral agent (CHEBI:22587) |
| candesartan (CHEBI:3347) has role cardiovascular drug (CHEBI:35554) |
| candesartan (CHEBI:3347) has role environmental contaminant (CHEBI:78298) |
| candesartan (CHEBI:3347) has role hypoglycemic agent (CHEBI:35526) |
| candesartan (CHEBI:3347) has role xenobiotic (CHEBI:35703) |
| candesartan (CHEBI:3347) is a benzimidazolecarboxylic acid (CHEBI:35688) |
| candesartan (CHEBI:3347) is a biphenylyltetrazole (CHEBI:48420) |
| candesartan (CHEBI:3347) is conjugate acid of candesartan(2−) (CHEBI:149509) |
| Incoming Relation(s) |
| candesartan(2−) (CHEBI:149509) is conjugate base of candesartan (CHEBI:3347) |
| IUPAC Name |
|---|
| 2-ethoxy-1-({2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl}methyl)-1H-benzimidazole-7-carboxylic acid |
| Synonyms | Source |
|---|---|
| 2-ethoxy-1-{[2'-(1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-1H-benzimidazole-7-carboxylic acid | IUPAC |
| 2-ethoxy-1-{[2'-(1H-tetrazol-5-yl)biphenyl-4ethyl]}-1H-benzimidazole-7-carboxylic acid | IUPHAR |
| 2-ethoxy-1-(p-(o-1H-tetrazol-5-ylphenyl)benzyl)-7-benzimidazolecarboxylic acid | ChemIDplus |
| Candemore | ChEMBL |
| Candesartan | ChEMBL |
| Candesartan cilexetil related compound g | ChEMBL |
| Brand Name | Source |
|---|---|
| Blopress | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| C07468 | KEGG COMPOUND |
| Candesartan | Wikipedia |
| D00522 | KEGG DRUG |
| DB00796 | DrugBank |
| EP459136 | Patent |
| HMDB0014934 | HMDB |
| LSM-5903 | LINCS |
| US5196444 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6377719 | Reaxys |
| CAS:139481-59-7 | ChemIDplus |
| CAS:139481-59-7 | KEGG COMPOUND |
| Citations |
|---|