EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H20N6O3 |
| Net Charge | 0 |
| Average Mass | 440.463 |
| Monoisotopic Mass | 440.15969 |
| SMILES | CCOc1nc2cccc(C(=O)O)c2n1Cc1ccc(-c2ccccc2-c2nnnn2)cc1 |
| InChI | InChI=1S/C24H20N6O3/c1-2-33-24-25-20-9-5-8-19(23(31)32)21(20)30(24)14-15-10-12-16(13-11-15)17-6-3-4-7-18(17)22-26-28-29-27-22/h3-13H,2,14H2,1H3,(H,31,32)(H,26,27,28,29) |
| InChIKey | HTQMVQVXFRQIKW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. |
| Applications: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| candesartan (CHEBI:3347) has role angiotensin receptor antagonist (CHEBI:61016) |
| candesartan (CHEBI:3347) has role antihypertensive agent (CHEBI:35674) |
| candesartan (CHEBI:3347) has role environmental contaminant (CHEBI:78298) |
| candesartan (CHEBI:3347) has role xenobiotic (CHEBI:35703) |
| candesartan (CHEBI:3347) is a benzimidazolecarboxylic acid (CHEBI:35688) |
| candesartan (CHEBI:3347) is a biphenylyltetrazole (CHEBI:48420) |
| candesartan (CHEBI:3347) is conjugate acid of candesartan(2−) (CHEBI:149509) |
| Incoming Relation(s) |
| candesartan(2−) (CHEBI:149509) is conjugate base of candesartan (CHEBI:3347) |
| IUPAC Name |
|---|
| 2-ethoxy-1-({2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl}methyl)-1H-benzimidazole-7-carboxylic acid |
| Synonyms | Source |
|---|---|
| 2-ethoxy-1-{[2'-(1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-1H-benzimidazole-7-carboxylic acid | IUPAC |
| 2-ethoxy-1-{[2'-(1H-tetrazol-5-yl)biphenyl-4ethyl]}-1H-benzimidazole-7-carboxylic acid | IUPHAR |
| 2-ethoxy-1-(p-(o-1H-tetrazol-5-ylphenyl)benzyl)-7-benzimidazolecarboxylic acid | ChemIDplus |
| CV-11974 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Blopress | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| C07468 | KEGG COMPOUND |
| Candesartan | Wikipedia |
| D00522 | KEGG DRUG |
| DB00796 | DrugBank |
| EP459136 | Patent |
| HMDB0014934 | HMDB |
| LSM-5903 | LINCS |
| US5196444 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6377719 | Reaxys |
| CAS:139481-59-7 | KEGG COMPOUND |
| CAS:139481-59-7 | ChemIDplus |
| Citations |
|---|