EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N3O3 |
| Net Charge | 0 |
| Average Mass | 357.454 |
| Monoisotopic Mass | 357.20524 |
| SMILES | [H][C@@]12C[C@@H](OC(=O)c3cccn3)CCN1C[C@@H]1C[C@H]2CN2C(=O)CCC[C@]12[H] |
| InChI | InChI=1S/C20H27N3O3/c24-19-5-1-4-17-13-9-14(12-23(17)19)18-10-15(6-8-22(18)11-13)26-20(25)16-3-2-7-21-16/h2-3,7,13-15,17-18,21H,1,4-6,8-12H2/t13?,14?,15-,17+,18-/m0/s1 |
| InChIKey | YFRYJFMFQOBOSY-CMQLYVPTSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Calpurnine (CHEBI:3331) is a quinolizidine alkaloid (CHEBI:26515) |
| Synonyms | Source |
|---|---|
| Calpurnine | KEGG COMPOUND |
| Hoe 933 | KEGG COMPOUND |