EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H48O |
| Net Charge | 0 |
| Average Mass | 412.702 |
| Monoisotopic Mass | 412.37052 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CC[C@@H](CC)C(C)C)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)CCC1=C |
| InChI | InChI=1S/C29H48O/c1-7-23(20(2)3)12-10-22(5)27-16-17-28-24(9-8-18-29(27,28)6)13-14-25-19-26(30)15-11-21(25)4/h13-14,20,22-23,26-28,30H,4,7-12,15-19H2,1-3,5-6H3/b24-13+,25-14-/t22-,23-,26+,27-,28+,29-/m1/s1 |
| InChIKey | RMDJVOZETBHEAR-LQYWTLTGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vitamin D5 (CHEBI:33279) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (3S,5Z,7E)-9,10-secostigmasta-5,7,10-trien-3-ol |
| Synonyms | Source |
|---|---|
| (3β,5Z,7E)-9,10-secostigmasta-5,7,10(19)-trien-3-ol | ChemIDplus |
| sitocalciferol | ChEBI |
| 24R-methylcalciol | ChemIDplus |
| (5Z,7E)-9,10-secostigmasta-5,7,10(19)-trien-3β-ol | ChEBI |
| (5Z,7E)-9,10-Secostigmasta-5,7,10(19)-trien-3beta-ol | KEGG COMPOUND |
| (1S,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(1R,4R)-4-Ethyl-1,5-dimethylhexyl]octahydro-7a-methyl-4H-inden-4-ylidene]ethylidene]-4-methylenecyclohexanol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C18193 | KEGG COMPOUND |
| FDB020368 | FooDB |
| HMDB0040586 | HMDB |
| Vitamin_D5 | Wikipedia |
| 8085275 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5616721 | Beilstein |
| Reaxys:10217937 | Reaxys |
| CAS:71761-06-3 | ChemIDplus |
| CAS:71761-06-3 | KEGG COMPOUND |
| Citations |
|---|