EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36O2 |
| Net Charge | 0 |
| Average Mass | 368.561 |
| Monoisotopic Mass | 368.27153 |
| SMILES | [H][C@@]1(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CCc2cc(O)ccc2O1 |
| InChI | InChI=1S/C25H36O2/c1-19(2)8-5-9-20(3)10-6-11-21(4)12-7-13-24-16-14-22-18-23(26)15-17-25(22)27-24/h8,10,12,15,17-18,24,26H,5-7,9,11,13-14,16H2,1-4H3/b20-10+,21-12+/t24-/m1/s1 |
| InChIKey | WSTGHGHPTQPFAP-JMFFIKRNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| didesmethyl tocotrienol (CHEBI:33278) is a tocotrienol (CHEBI:33235) |
| IUPAC Name |
|---|
| (2R)-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]-3,4-dihydro-2H-chromen-6-ol |
| Synonym | Source |
|---|---|
| 3,4-dihydro-2-(4,8,12-trimethyltrideca-3'(E),7'(E),11'-trienyl)-2H-1-benzopyran-6-ol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8727601 | Beilstein |