EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:33276 - δ-tocotrienol
| Formula | C27H40O2 |
| Net Charge | 0 |
| Average Mass | 396.615 |
| Monoisotopic Mass | 396.30283 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2cc(O)cc(C)c2O1 |
| InChI | InChI=1S/C27H40O2/c1-20(2)10-7-11-21(3)12-8-13-22(4)14-9-16-27(6)17-15-24-19-25(28)18-23(5)26(24)29-27/h10,12,14,18-19,28H,7-9,11,13,15-17H2,1-6H3/b21-12+,22-14+/t27-/m1/s1 |
| InChIKey | ODADKLYLWWCHNB-LDYBVBFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (32580548) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. radiation protective agent Any compound that is able to protect normal cells from the damage caused by radiation therapy. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| δ-tocotrienol (CHEBI:33276) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| δ-tocotrienol (CHEBI:33276) has role anti-inflammatory agent (CHEBI:67079) |
| δ-tocotrienol (CHEBI:33276) has role antineoplastic agent (CHEBI:35610) |
| δ-tocotrienol (CHEBI:33276) has role apoptosis inducer (CHEBI:68495) |
| δ-tocotrienol (CHEBI:33276) has role bone density conservation agent (CHEBI:50646) |
| δ-tocotrienol (CHEBI:33276) has role NF-κB inhibitor (CHEBI:73240) |
| δ-tocotrienol (CHEBI:33276) has role plant metabolite (CHEBI:76924) |
| δ-tocotrienol (CHEBI:33276) has role radiation protective agent (CHEBI:66987) |
| δ-tocotrienol (CHEBI:33276) is a tocotrienol (CHEBI:33235) |
| δ-tocotrienol (CHEBI:33276) is a vitamin E (CHEBI:33234) |
| IUPAC Name |
|---|
| (2R)-2,8-dimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]-3,4-dihydro-2H-chromen-6-ol |
| Synonyms | Source |
|---|---|
| δ-tocotrienol | ChemIDplus |
| delta-tocotrienol | KEGG COMPOUND |
| (2R)-2,8-dimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]-3,4-dihydro-2H-1-benzopyran-6-ol | IUPAC |
| UniProt Name | Source |
|---|---|
| δ-tocotrienol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C14156 | KEGG COMPOUND |
| C00035077 | KNApSAcK |
| HMDB0030008 | HMDB |
| CPD-15839 | MetaCyc |
| FDB001299 | FooDB |
| LMPR02020056 | LIPID MAPS |
| WO2009126866 | Patent |
| 4445515 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5449575 | Reaxys |
| CAS:25612-59-3 | ChemIDplus |
| CAS:25612-59-3 | NIST Chemistry WebBook |
| Citations |
|---|