EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:33276 - δ-tocotrienol
| Formula | C27H40O2 |
| Net Charge | 0 |
| Average Mass | 396.615 |
| Monoisotopic Mass | 396.30283 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2cc(O)cc(C)c2O1 |
| InChI | InChI=1S/C27H40O2/c1-20(2)10-7-11-21(3)12-8-13-22(4)14-9-16-27(6)17-15-24-19-25(28)18-23(5)26(24)29-27/h10,12,14,18-19,28H,7-9,11,13,15-17H2,1-6H3/b21-12+,22-14+/t27-/m1/s1 |
| InChIKey | ODADKLYLWWCHNB-LDYBVBFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (32580548) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. radiation protective agent Any compound that is able to protect normal cells from the damage caused by radiation therapy. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| δ-tocotrienol (CHEBI:33276) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| δ-tocotrienol (CHEBI:33276) has role anti-inflammatory agent (CHEBI:67079) |
| δ-tocotrienol (CHEBI:33276) has role antineoplastic agent (CHEBI:35610) |
| δ-tocotrienol (CHEBI:33276) has role apoptosis inducer (CHEBI:68495) |
| δ-tocotrienol (CHEBI:33276) has role bone density conservation agent (CHEBI:50646) |
| δ-tocotrienol (CHEBI:33276) has role NF-κB inhibitor (CHEBI:73240) |
| δ-tocotrienol (CHEBI:33276) has role plant metabolite (CHEBI:76924) |
| δ-tocotrienol (CHEBI:33276) has role radiation protective agent (CHEBI:66987) |
| δ-tocotrienol (CHEBI:33276) is a tocotrienol (CHEBI:33235) |
| δ-tocotrienol (CHEBI:33276) is a vitamin E (CHEBI:33234) |
| IUPAC Name |
|---|
| (2R)-2,8-dimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]-3,4-dihydro-2H-chromen-6-ol |
| Synonyms | Source |
|---|---|
| (2R)-2,8-dimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]-3,4-dihydro-2H-1-benzopyran-6-ol | IUPAC |
| delta-tocotrienol | KEGG COMPOUND |
| δ-tocotrienol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| δ-tocotrienol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4445515 | ChemSpider |
| C00035077 | KNApSAcK |
| C14156 | KEGG COMPOUND |
| CPD-15839 | MetaCyc |
| FDB001299 | FooDB |
| HMDB0030008 | HMDB |
| LMPR02020056 | LIPID MAPS |
| WO2009126866 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5449575 | Reaxys |
| CAS:25612-59-3 | ChemIDplus |
| CAS:25612-59-3 | NIST Chemistry WebBook |
| Citations |
|---|