EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H42O2 |
| Net Charge | 0 |
| Average Mass | 410.642 |
| Monoisotopic Mass | 410.31848 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2c(C)c(O)cc(C)c2O1 |
| InChI | InChI=1S/C28H42O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-24(6)26(29)19-23(5)27(25)30-28/h11,13,15,19,29H,8-10,12,14,16-18H2,1-7H3/b21-13+,22-15+/t28-/m1/s1 |
| InChIKey | FGYKUFVNYVMTAM-WAZJVIJMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-tocotrienol (CHEBI:33275) has role antineoplastic agent (CHEBI:35610) |
| β-tocotrienol (CHEBI:33275) has role apoptosis inducer (CHEBI:68495) |
| β-tocotrienol (CHEBI:33275) has role plant metabolite (CHEBI:76924) |
| β-tocotrienol (CHEBI:33275) is a tocotrienol (CHEBI:33235) |
| β-tocotrienol (CHEBI:33275) is a vitamin E (CHEBI:33234) |
| IUPAC Name |
|---|
| (2R)-2,5,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]-3,4-dihydro-2H-chromen-6-ol |
| Synonyms | Source |
|---|---|
| ε-tocopherol | ChemIDplus |
| (2R)-3,4-dihydro-2,5,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyl-3,7,11-tridecatrienyl]-2H-1-benzopyran-6-ol | ChemIDplus |
| β-tocotrienol | ChemIDplus |
| beta-tocotrienol | KEGG COMPOUND |
| (2R)-2,5,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]-3,4-dihydro-2H-1-benzopyran-6-ol | IUPAC |
| UniProt Name | Source |
|---|---|
| β-tocotrienol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C14154 | KEGG COMPOUND |
| LMPR02020055 | LIPID MAPS |
| CPD-15837 | MetaCyc |
| MX2010003631 | Patent |
| CN101842488 | Patent |
| EP2198029 | Patent |
| US2007021497 | Patent |
| Beta-Tocotrienol | Wikipedia |
| HMDB0030554 | HMDB |
| FDB002433 | FooDB |
| C00035060 | KNApSAcK |
| 4445513 | ChemSpider |
| US2011113503 | Patent |
| EP1948808 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:43513 | Reaxys |
| CAS:490-23-3 | ChemIDplus |
| CAS:490-23-3 | KEGG COMPOUND |
| Citations |
|---|