EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O4 |
| Net Charge | 0 |
| Average Mass | 296.322 |
| Monoisotopic Mass | 296.10486 |
| SMILES | CC(C)=CCc1ccc2c(=O)c3c(O)cccc3oc2c1O |
| InChI | InChI=1S/C18H16O4/c1-10(2)6-7-11-8-9-12-17(21)15-13(19)4-3-5-14(15)22-18(12)16(11)20/h3-6,8-9,19-20H,7H2,1-2H3 |
| InChIKey | APHJPNXEBUUMKB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calophyllum inophyllum (ncbitaxon:158927) | - | PubMed (15678383) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calophyllin B (CHEBI:3327) has role plant metabolite (CHEBI:76924) |
| calophyllin B (CHEBI:3327) is a polyphenol (CHEBI:26195) |
| calophyllin B (CHEBI:3327) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,5-dihydroxy-6-(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
| Synonyms | Source |
|---|---|
| 6-(3,3-Dimethylallyl)-1,5-dihydroxyxanthone | KEGG COMPOUND |
| guanandin | ChEBI |
| Citations |
|---|