EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46O |
| Net Charge | 0 |
| Average Mass | 398.675 |
| Monoisotopic Mass | 398.35487 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CC[C@H](C)C(C)C)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)CCC1=C |
| InChI | InChI=1S/C28H46O/c1-19(2)20(3)9-10-22(5)26-15-16-27-23(8-7-17-28(26,27)6)12-13-24-18-25(29)14-11-21(24)4/h12-13,19-20,22,25-27,29H,4,7-11,14-18H2,1-3,5-6H3/b23-12+,24-13-/t20-,22+,25-,26+,27-,28+/m0/s1 |
| InChIKey | DIPPFEXMRDPFBK-JPWDPSJFSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Agaricus bisporus (ncbitaxon:5341) | - | PubMed (27323764) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vitamin D4 (CHEBI:33237) has role fungal metabolite (CHEBI:76946) |
| vitamin D4 (CHEBI:33237) is a seco-ergostane (CHEBI:36819) |
| vitamin D4 (CHEBI:33237) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (3S,5Z,7E)-9,10-secoergosta-5,7,10(19)-trien-3-ol |
| Synonyms | Source |
|---|---|
| 22,23-dihydroercalciol | JCBN |
| 22,23-dihydroergocalciferol | JCBN |
| 22-Dihydroergocalciferol | KEGG COMPOUND |
| (24S)-methylcalciol | JCBN |
| 24S-methylcalciol | ChemIDplus |
| (3S)-9,10-seco-5Z,7E,10(19)-ergostatrien-3-ol | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| 22-Dihydroergocalciferol | Wikipedia |
| 4574179 | ChemSpider |
| C18192 | KEGG COMPOUND |
| LMST03030001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3221782 | Beilstein |
| CAS:511-28-4 | ChemIDplus |
| Citations |
|---|