EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H14N4 |
| Net Charge | 0 |
| Average Mass | 298.349 |
| Monoisotopic Mass | 298.12185 |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5ccc(n5)c1n2)n4)n3 |
| InChI | InChI=1S/C19H14N4/c1-3-14-10-16-5-7-18(22-16)19-8-6-17(23-19)11-15-4-2-13(21-15)9-12(1)20-14/h1-11,20-22H/b12-9-,13-9-,14-10-,15-11-,16-10-,17-11-,19-18- |
| InChIKey | LYNARWYQOUZXDY-MXCYJBDUSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| corrole (CHEBI:33222) is a corroles (CHEBI:23393) |
| corrole (CHEBI:33222) is a tetrapyrrole fundamental parent (CHEBI:35794) |
| Synonyms | Source |
|---|---|
| corrole | IUBMB |
| octadehydrocorrin | IUBMB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1150134 | Reaxys |
| Reaxys:14648833 | Reaxys |