EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9HgO2S |
| Net Charge | -1 |
| Average Mass | 381.826 |
| Monoisotopic Mass | 383.00352 |
| SMILES | C[CH2][Hg][S]c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C7H6O2S.C2H5.Hg/c8-7(9)5-3-1-2-4-6(5)10;1-2;/h1-4,10H,(H,8,9);1H2,2H3;/q;;+1/p-2 |
| InChIKey | HXQVQGWHFRNKMS-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethylmercurithiosalicylate (CHEBI:33215) is a alkylmercury compound (CHEBI:33255) |
| ethylmercurithiosalicylate (CHEBI:33215) is a benzoates (CHEBI:22718) |
| ethylmercurithiosalicylate (CHEBI:33215) is conjugate base of ethylmercurithiosalicylic acid (CHEBI:33214) |
| Incoming Relation(s) |
| thimerosal (CHEBI:9546) has part ethylmercurithiosalicylate (CHEBI:33215) |
| ethylmercurithiosalicylic acid (CHEBI:33214) is conjugate acid of ethylmercurithiosalicylate (CHEBI:33215) |
| IUPAC Name |
|---|
| [(2-carboxylatophenyl)sulfanyl](ethyl)mercurate(1−) |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1675626 | Gmelin |