EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4N2O2S |
| Net Charge | 0 |
| Average Mass | 144.155 |
| Monoisotopic Mass | 143.99935 |
| SMILES | O=C1CC(=O)NC(=S)N1 |
| InChI | InChI=1S/C4H4N2O2S/c7-2-1-3(8)6-4(9)5-2/h1H2,(H2,5,6,7,8,9) |
| InChIKey | RVBUGGBMJDPOST-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | reagent A substance used in a chemical reaction to detect, measure, examine, or produce other substances. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-thiobarbituric acid (CHEBI:33202) has role allergen (CHEBI:50904) |
| 2-thiobarbituric acid (CHEBI:33202) has role reagent (CHEBI:33893) |
| 2-thiobarbituric acid (CHEBI:33202) is a barbiturates (CHEBI:22693) |
| Incoming Relation(s) |
| thiopental (CHEBI:102166) has functional parent 2-thiobarbituric acid (CHEBI:33202) |
| IUPAC Name |
|---|
| 2-sulfanylidenedihydropyrimidine-4,6(1H,5H)-dione |
| Synonyms | Source |
|---|---|
| 2-thioxodihydropyrimidine-4,6(1H,5H)-dione | IUPAC |
| dihydro-2-thioxo-4,6(1H,5H)-pyrimidinedione | ChemIDplus |
| thiobarbituric acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Thiobarbituric_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Gmelin:101333 | Gmelin |
| Reaxys:120663 | Reaxys |
| CAS:504-17-6 | ChemIDplus |
| Citations |
|---|