EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H36O3 |
| Net Charge | 0 |
| Average Mass | 300.483 |
| Monoisotopic Mass | 300.26645 |
| SMILES | CCCCCCCC[C@@H](O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O3/c1-2-3-4-5-8-11-14-17(19)15-12-9-6-7-10-13-16-18(20)21/h17,19H,2-16H2,1H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | PAZZVPKITDJCPV-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-10-hydroxyoctadecanoic acid (CHEBI:33197) is a hydroxyoctadecanoic acid (CHEBI:24747) |
| (R)-10-hydroxyoctadecanoic acid (CHEBI:33197) is conjugate acid of (R)-10-hydroxyoctadecanoate (CHEBI:15683) |
| Incoming Relation(s) |
| (R)-10-hydroxyoctadecanoate (CHEBI:15683) is conjugate base of (R)-10-hydroxyoctadecanoic acid (CHEBI:33197) |
| IUPAC Name |
|---|
| (10R)-10-hydroxyoctadecanoic acid |
| Synonym | Source |
|---|---|
| (10R)-10-hydroxystearic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C03195 | KEGG COMPOUND |
| LMFA02000237 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6720081 | Reaxys |
| CAS:638-26-6 | KEGG COMPOUND |