EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8N8O8 |
| Net Charge | 0 |
| Average Mass | 296.156 |
| Monoisotopic Mass | 296.04651 |
| SMILES | O=[N+]([O-])N1CN([N+](=O)[O-])CN([N+](=O)[O-])CN([N+](=O)[O-])C1 |
| InChI | InChI=1S/C4H8N8O8/c13-9(14)5-1-6(10(15)16)3-8(12(19)20)4-7(2-5)11(17)18/h1-4H2 |
| InChIKey | UZGLIIJVICEWHF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| octogen (CHEBI:33176) has role explosive (CHEBI:63490) |
| octogen (CHEBI:33176) is a N-nitro compound (CHEBI:38780) |
| octogen (CHEBI:33176) is a tetrazocane (CHEBI:38788) |
| IUPAC Name |
|---|
| 1,3,5,7-tetranitro-1,3,5,7-tetraazocane |
| Synonyms | Source |
|---|---|
| 1,3,5,7-tetranitro-1,3,5,7-tetraazacyclooctane | NIST Chemistry WebBook |
| 1,3,5,7-tetranitro-1,3,5,7-tetrazocane | IUPAC |
| cyclotetramethylene tetranitramine | NIST Chemistry WebBook |
| HMX | NIST Chemistry WebBook |
| octahydro-1,3,5,7-tetranitro-1,3,5,7-tetrazocine | NIST Chemistry WebBook |
| octogen | ChemIDplus |
| Citations |
|---|