EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H18 |
| Net Charge | 0 |
| Average Mass | 378.474 |
| Monoisotopic Mass | 378.14085 |
| SMILES | c1ccc2c(c1)ccc1ccc3ccc4ccc5ccc6ccccc6c5c4c3c12 |
| InChI | InChI=1S/C30H18/c1-3-7-25-19(5-1)9-11-21-13-15-23-17-18-24-16-14-22-12-10-20-6-2-4-8-26(20)28(22)30(24)29(23)27(21)25/h1-18H |
| InChIKey | ZADYHNRFHQXTOH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heptahelicene (CHEBI:33153) is a helicene (CHEBI:35302) |
| IUPAC Name |
|---|
| heptahelicene |
| Synonym | Source |
|---|---|
| dinaphtho[2,1-c:1',2'-g]phenanthrene | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1889441 | Beilstein |
| CAS:16914-68-4 | NIST Chemistry WebBook |