EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H16 |
| Net Charge | 0 |
| Average Mass | 328.414 |
| Monoisotopic Mass | 328.12520 |
| SMILES | c1ccc2cc3cc4c(ccc5cc6ccccc6cc54)cc3cc2c1 |
| InChI | InChI=1S/C26H16/c1-2-7-19-13-24-16-26-22(14-23(24)12-18(19)6-1)10-9-21-11-17-5-3-4-8-20(17)15-25(21)26/h1-16H |
| InChIKey | PKIFBGYEEVFWTJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexaphene (CHEBI:33151) is a ortho-fused polycyclic arene (CHEBI:35296) |
| IUPAC Name |
|---|
| hexaphene |